hexyl 3-methylbutanoate


hexyl 3-methylbutanoate
CAS RN:[10032-13-0]
Formula:C11H22O2; 186.29 g/mol
InChiKey:RSDDTPVXLMVLQE-UHFFFAOYSA-N
SMILES:CCCCCCOC(=O)CC(C)C
Molecular structure of hexyl 3-methylbutanoate
Density:0.857 g/mL
Molar volume:217.4 mL/mol
Boiling point:215 °C

Isomers

1-(2-butenyloxy)-2-(3-methylbutoxy)ethane
Molecular structure of 1-(2-butenyloxy)-2-(3-methylbutoxy)ethane
1-(2-butenyloxy)-2-pentoxyethane
Molecular structure of 1-(2-butenyloxy)-2-pentoxyethane
butyl heptanoate
Molecular structure of butyl heptanoate
1-tert-butylperoxy-1-methylcyclohexane
Molecular structure of 1-tert-butylperoxy-1-methylcyclohexane
decyl formate
Molecular structure of decyl formate
6,6-dimethoxy-2,5,5-trimethylhex-2-ene
Molecular structure of 6,6-dimethoxy-2,5,5-trimethylhex-2-ene
ethyl nonanoate
Molecular structure of ethyl nonanoate
ethyl 3,5,5-trimethylhexanoate
Molecular structure of ethyl 3,5,5-trimethylhexanoate
heptyl butanoate
Molecular structure of heptyl butanoate
heptyl butyrate
Molecular structure of heptyl butyrate
hexyl 2-methylbutanoate
Molecular structure of hexyl 2-methylbutanoate
hexyl 3-methylbutanoate
Molecular structure of hexyl 3-methylbutanoate
hexyl pentanoate
Molecular structure of hexyl pentanoate
3-methylbutyl hexanoate
Molecular structure of 3-methylbutyl hexanoate
methyl decanoate
Molecular structure of methyl decanoate
nonyl acetate
Molecular structure of nonyl acetate
octyl propanoate
Molecular structure of octyl propanoate
pentyl hexanoate
Molecular structure of pentyl hexanoate
propan-2-yl octanoate
Molecular structure of propan-2-yl octanoate
propyl octanoate
Molecular structure of propyl octanoate
3,5,5-trimethylhexyl acetate
Molecular structure of 3,5,5-trimethylhexyl acetate
undecanoic acid
Molecular structure of undecanoic acid